C12H18F3N5O — CID 79282278
1-methyl-3-propyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]imidazo[4,5-d]pyrazol-5-amine (PubChem CID 79282278) has the molecular formula C12H18F3N5O and a molecular weight of 305.30 g/mol. Its IUPAC name is 1-methyl-3-propyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]imidazo[4,5-d]pyrazol-5-amine.
| Compound Name | 1-methyl-3-propyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]imidazo[4,5-d]pyrazol-5-amine |
|---|---|
| PubChem CID | 79282278 |
| Molecular Formula | C12H18F3N5O |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1-methyl-3-propyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]imidazo[4,5-d]pyrazol-5-amine |
| SMILES | CCCc1nn(C)c2c1nc(N)n2CCOCC(F)(F)F |
| InChI | InChI=1S/C12H18F3N5O/c1-3-4-8-9-10(19(2)18-8)20(11(16)17-9)5-6-21-7-12(13,14)15/h3-7H2,1-2H3,(H2,16,17) |
| InChIKey | PZSJWAADNXSLNI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|