C10H12N4O4 — CID 79283999
2-[[2-[(5-methyl-1,3,4-oxadiazol-2-yl)amino]-2-oxoethyl]-prop-2-ynylamino]acetic acid (PubChem CID 79283999) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is 2-[[2-[(5-methyl-1,3,4-oxadiazol-2-yl)amino]-2-oxoethyl]-prop-2-ynylamino]acetic acid.
| Compound Name | 2-[[2-[(5-methyl-1,3,4-oxadiazol-2-yl)amino]-2-oxoethyl]-prop-2-ynylamino]acetic acid |
|---|---|
| PubChem CID | 79283999 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-[[2-[(5-methyl-1,3,4-oxadiazol-2-yl)amino]-2-oxoethyl]-prop-2-ynylamino]acetic acid |
| SMILES | C#CCN(CC(=O)O)CC(=O)Nc1nnc(C)o1 |
| InChI | InChI=1S/C10H12N4O4/c1-3-4-14(6-9(16)17)5-8(15)11-10-13-12-7(2)18-10/h1H,4-6H2,2H3,(H,16,17)(H,11,13,15) |
| InChIKey | IBWIYEJYBHNACX-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|