About 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole
6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole (PubChem CID 79284447) has the molecular formula C14H13Cl2FN4
and a molecular weight of 327.19 g/mol. Its IUPAC name is 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole.
Molecular Properties
| Compound Name | 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole |
| PubChem CID | 79284447 |
| Molecular Formula | C14H13Cl2FN4 |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole |
| SMILES | CCn1nc(C)c2nc(CCl)n(-c3ccc(F)c(Cl)c3)c21 |
| InChI | InChI=1S/C14H13Cl2FN4/c1-3-20-14-13(8(2)19-20)18-12(7-15)21(14)9-4-5-11(17)10(16)6-9/h4-6H,3,7H2,1-2H3 |
| InChIKey | OVMHVHYMTORPNJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole?
The IUPAC name of 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole (CID 79284447) is 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole.
What is the SMILES notation for 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole?
The canonical SMILES for 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole is CCn1nc(C)c2nc(CCl)n(-c3ccc(F)c(Cl)c3)c21.
What is the InChIKey of 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole?
The InChIKey is OVMHVHYMTORPNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2FN4/c1-3-20-14-13(8(2)19-20)18-12(7-15)21(14)9-4-5-11(17)10(16)6-9/h4-6H,3,7H2,1-2H3.
What are the key properties of 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole?
6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole has a molecular weight of 327.19 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-chloro-4-fluorophenyl)-5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazole is sourced from PubChem (CID 79284447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).