About 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine
2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine (PubChem CID 79284812) has the molecular formula C15H26ClN5
and a molecular weight of 311.86 g/mol. Its IUPAC name is 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine |
| PubChem CID | 79284812 |
| Molecular Formula | C15H26ClN5 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1c(C(C)Cl)nc2c(C)nn(CC)c21 |
| InChI | InChI=1S/C15H26ClN5/c1-6-19(7-2)9-10-20-14(11(4)16)17-13-12(5)18-21(8-3)15(13)20/h11H,6-10H2,1-5H3 |
| InChIKey | ZWRWCAISCORDHN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine?
The IUPAC name of 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine (CID 79284812) is 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine.
What is the SMILES notation for 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine?
The canonical SMILES for 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine is CCN(CC)CCn1c(C(C)Cl)nc2c(C)nn(CC)c21.
What is the InChIKey of 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine?
The InChIKey is ZWRWCAISCORDHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26ClN5/c1-6-19(7-2)9-10-20-14(11(4)16)17-13-12(5)18-21(8-3)15(13)20/h11H,6-10H2,1-5H3.
What are the key properties of 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine?
2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine has a molecular weight of 311.86 g/mol, XLogP of 3.20, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(1-chloroethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-diethylethanamine is sourced from PubChem (CID 79284812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).