C14H19N3O2 — CID 79285015
N,4-dimethyl-3-[[2-(prop-2-enylamino)acetyl]amino]benzamide (PubChem CID 79285015) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N,4-dimethyl-3-[[2-(prop-2-enylamino)acetyl]amino]benzamide.
| Compound Name | N,4-dimethyl-3-[[2-(prop-2-enylamino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 79285015 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N,4-dimethyl-3-[[2-(prop-2-enylamino)acetyl]amino]benzamide |
| SMILES | C=CCNCC(=O)Nc1cc(C(=O)NC)ccc1C |
| InChI | InChI=1S/C14H19N3O2/c1-4-7-16-9-13(18)17-12-8-11(14(19)15-3)6-5-10(12)2/h4-6,8,16H,1,7,9H2,2-3H3,(H,15,19)(H,17,18) |
| InChIKey | GRLKOTJMMSVZHS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|