C11H19N3O — CID 79286034
N-(2-cyanoethyl)-N-propan-2-yl-2-(prop-2-enylamino)acetamide (PubChem CID 79286034) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-propan-2-yl-2-(prop-2-enylamino)acetamide.
| Compound Name | N-(2-cyanoethyl)-N-propan-2-yl-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 79286034 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-(2-cyanoethyl)-N-propan-2-yl-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)N(CCC#N)C(C)C |
| InChI | InChI=1S/C11H19N3O/c1-4-7-13-9-11(15)14(10(2)3)8-5-6-12/h4,10,13H,1,5,7-9H2,2-3H3 |
| InChIKey | DZTQFWKKFBMPSF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|