C12H11FN2O3 — CID 79286925
2-fluoro-5-[[2-(prop-2-ynylamino)acetyl]amino]benzoic acid (PubChem CID 79286925) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is 2-fluoro-5-[[2-(prop-2-ynylamino)acetyl]amino]benzoic acid.
| Compound Name | 2-fluoro-5-[[2-(prop-2-ynylamino)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 79286925 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-fluoro-5-[[2-(prop-2-ynylamino)acetyl]amino]benzoic acid |
| SMILES | C#CCNCC(=O)Nc1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H11FN2O3/c1-2-5-14-7-11(16)15-8-3-4-10(13)9(6-8)12(17)18/h1,3-4,6,14H,5,7H2,(H,15,16)(H,17,18) |
| InChIKey | XVWSEOMPZALUPC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|