About N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide
N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide (PubChem CID 79287533) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide.
Molecular Properties
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide |
| PubChem CID | 79287533 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide |
| SMILES | C#CCNCC(=O)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C11H14N4O/c1-4-5-12-7-10(16)15-11-13-8(2)6-9(3)14-11/h1,6,12H,5,7H2,2-3H3,(H,13,14,15,16) |
| InChIKey | OTCKQCRAGJRDCQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide?
The IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide (CID 79287533) is N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide.
What is the SMILES notation for N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide?
The canonical SMILES for N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide is C#CCNCC(=O)Nc1nc(C)cc(C)n1.
What is the InChIKey of N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide?
The InChIKey is OTCKQCRAGJRDCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O/c1-4-5-12-7-10(16)15-11-13-8(2)6-9(3)14-11/h1,6,12H,5,7H2,2-3H3,(H,13,14,15,16).
What are the key properties of N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide?
N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide has a molecular weight of 218.26 g/mol, XLogP of 0.25, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethylpyrimidin-2-yl)-2-(prop-2-ynylamino)acetamide is sourced from PubChem (CID 79287533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).