C15H20N2O — CID 79287564
N-[1-(2,4-dimethylphenyl)ethyl]-2-(prop-2-ynylamino)acetamide (PubChem CID 79287564) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)ethyl]-2-(prop-2-ynylamino)acetamide.
| Compound Name | N-[1-(2,4-dimethylphenyl)ethyl]-2-(prop-2-ynylamino)acetamide |
|---|---|
| PubChem CID | 79287564 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)ethyl]-2-(prop-2-ynylamino)acetamide |
| SMILES | C#CCNCC(=O)NC(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C15H20N2O/c1-5-8-16-10-15(18)17-13(4)14-7-6-11(2)9-12(14)3/h1,6-7,9,13,16H,8,10H2,2-4H3,(H,17,18) |
| InChIKey | PEKPJAUPDUQNEJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|