About 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine
3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine (PubChem CID 79287858) has the molecular formula C14H23N5
and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine |
| PubChem CID | 79287858 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1ccnc2c1nc(N)n2CC(C)(C)CN(C)C |
| InChI | InChI=1S/C14H23N5/c1-10-6-7-16-12-11(10)17-13(15)19(12)9-14(2,3)8-18(4)5/h6-7H,8-9H2,1-5H3,(H2,15,17) |
| InChIKey | PPSBQJJGEAXEFN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine?
The IUPAC name of 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine (CID 79287858) is 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine.
What is the SMILES notation for 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine?
The canonical SMILES for 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine is Cc1ccnc2c1nc(N)n2CC(C)(C)CN(C)C.
What is the InChIKey of 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine?
The InChIKey is PPSBQJJGEAXEFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5/c1-10-6-7-16-12-11(10)17-13(15)19(12)9-14(2,3)8-18(4)5/h6-7H,8-9H2,1-5H3,(H2,15,17).
What are the key properties of 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine?
3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine has a molecular weight of 261.37 g/mol, XLogP of 1.91, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(dimethylamino)-2,2-dimethylpropyl]-7-methylimidazo[4,5-b]pyridin-2-amine is sourced from PubChem (CID 79287858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).