C12H14ClN5S — CID 79287886
4-[[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]methyl]-1,3-thiazole (PubChem CID 79287886) has the molecular formula C12H14ClN5S and a molecular weight of 295.80 g/mol. Its IUPAC name is 4-[[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]methyl]-1,3-thiazole.
| Compound Name | 4-[[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79287886 |
| Molecular Formula | C12H14ClN5S |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 4-[[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]methyl]-1,3-thiazole |
| SMILES | Cc1nn(C)c2c1nc(C(C)Cl)n2Cc1cscn1 |
| InChI | InChI=1S/C12H14ClN5S/c1-7(13)11-15-10-8(2)16-17(3)12(10)18(11)4-9-5-19-6-14-9/h5-7H,4H2,1-3H3 |
| InChIKey | IFJASEAIVRESSI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|