About 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole
5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole (PubChem CID 79288113) has the molecular formula C12H19ClN4
and a molecular weight of 254.76 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole.
Molecular Properties
| Compound Name | 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole |
| PubChem CID | 79288113 |
| Molecular Formula | C12H19ClN4 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole |
| SMILES | CCC(C)Cn1c(CCl)nc2c(C)nn(C)c21 |
| InChI | InChI=1S/C12H19ClN4/c1-5-8(2)7-17-10(6-13)14-11-9(3)15-16(4)12(11)17/h8H,5-7H2,1-4H3 |
| InChIKey | ZZESAJCKSMACOI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole?
The IUPAC name of 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole (CID 79288113) is 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole.
What is the SMILES notation for 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole?
The canonical SMILES for 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole is CCC(C)Cn1c(CCl)nc2c(C)nn(C)c21.
What is the InChIKey of 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole?
The InChIKey is ZZESAJCKSMACOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClN4/c1-5-8(2)7-17-10(6-13)14-11-9(3)15-16(4)12(11)17/h8H,5-7H2,1-4H3.
What are the key properties of 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole?
5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole has a molecular weight of 254.76 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-1,3-dimethyl-6-(2-methylbutyl)imidazo[4,5-d]pyrazole is sourced from PubChem (CID 79288113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).