C13H16ClN5S — CID 79288614
2-[2-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]ethyl]-4-methyl-1,3-thiazole (PubChem CID 79288614) has the molecular formula C13H16ClN5S and a molecular weight of 309.83 g/mol. Its IUPAC name is 2-[2-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]ethyl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[2-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]ethyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 79288614 |
| Molecular Formula | C13H16ClN5S |
| Molecular Weight | 309.83 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-[2-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]ethyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(CCn2c(CCl)nc3c(C)nn(C)c32)n1 |
| InChI | InChI=1S/C13H16ClN5S/c1-8-7-20-11(15-8)4-5-19-10(6-14)16-12-9(2)17-18(3)13(12)19/h7H,4-6H2,1-3H3 |
| InChIKey | VCXWZWBOOYMZOU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.83 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|