About 3-benzylimidazo[4,5-b]pyridin-2-amine
3-benzylimidazo[4,5-b]pyridin-2-amine (PubChem CID 79289249) has the molecular formula C13H12N4
and a molecular weight of 224.27 g/mol. Its IUPAC name is 3-benzylimidazo[4,5-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-benzylimidazo[4,5-b]pyridin-2-amine |
| PubChem CID | 79289249 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 3-benzylimidazo[4,5-b]pyridin-2-amine |
| SMILES | Nc1nc2cccnc2n1Cc1ccccc1 |
| InChI | InChI=1S/C13H12N4/c14-13-16-11-7-4-8-15-12(11)17(13)9-10-5-2-1-3-6-10/h1-8H,9H2,(H2,14,16) |
| InChIKey | DGQHLIFQEDQFMU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-benzylimidazo[4,5-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylimidazo[4,5-b]pyridin-2-amine?
The IUPAC name of 3-benzylimidazo[4,5-b]pyridin-2-amine (CID 79289249) is 3-benzylimidazo[4,5-b]pyridin-2-amine.
What is the SMILES notation for 3-benzylimidazo[4,5-b]pyridin-2-amine?
The canonical SMILES for 3-benzylimidazo[4,5-b]pyridin-2-amine is Nc1nc2cccnc2n1Cc1ccccc1.
What is the InChIKey of 3-benzylimidazo[4,5-b]pyridin-2-amine?
The InChIKey is DGQHLIFQEDQFMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4/c14-13-16-11-7-4-8-15-12(11)17(13)9-10-5-2-1-3-6-10/h1-8H,9H2,(H2,14,16).
What are the key properties of 3-benzylimidazo[4,5-b]pyridin-2-amine?
3-benzylimidazo[4,5-b]pyridin-2-amine has a molecular weight of 224.27 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylimidazo[4,5-b]pyridin-2-amine is sourced from PubChem (CID 79289249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).