C11H12N6S — CID 79289404
3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 79289404) has the molecular formula C11H12N6S and a molecular weight of 260.33 g/mol. Its IUPAC name is 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 79289404 |
| Molecular Formula | C11H12N6S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | Cn1cnnc1CCn1c(=S)[nH]c2cccnc21 |
| InChI | InChI=1S/C11H12N6S/c1-16-7-13-15-9(16)4-6-17-10-8(14-11(17)18)3-2-5-12-10/h2-3,5,7H,4,6H2,1H3,(H,14,18) |
| InChIKey | WVUSRDNVZQMZIK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|