C14H11N3O — CID 79291073
1,5,8-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaen-9-one (PubChem CID 79291073) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is 1,5,8-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaen-9-one.
| Compound Name | 1,5,8-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaen-9-one |
|---|---|
| PubChem CID | 79291073 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1,5,8-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaen-9-one |
| SMILES | O=C1Nc2cnccc2N2c3ccccc3CC12 |
| InChI | InChI=1S/C14H11N3O/c18-14-13-7-9-3-1-2-4-11(9)17(13)12-5-6-15-8-10(12)16-14/h1-6,8,13H,7H2,(H,16,18) |
| InChIKey | FZHGIIBVYMVRMK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |