About 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one
2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one (PubChem CID 79291259) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one |
| PubChem CID | 79291259 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one |
| SMILES | CCC(C)C1Nc2ccncc2NC1=O |
| InChI | InChI=1S/C11H15N3O/c1-3-7(2)10-11(15)14-9-6-12-5-4-8(9)13-10/h4-7,10,13H,3H2,1-2H3,(H,14,15) |
| InChIKey | BFKJPFZNVPCNPS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one?
The IUPAC name of 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one (CID 79291259) is 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one.
What is the SMILES notation for 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one?
The canonical SMILES for 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one is CCC(C)C1Nc2ccncc2NC1=O.
What is the InChIKey of 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one?
The InChIKey is BFKJPFZNVPCNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c1-3-7(2)10-11(15)14-9-6-12-5-4-8(9)13-10/h4-7,10,13H,3H2,1-2H3,(H,14,15).
What are the key properties of 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one?
2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one has a molecular weight of 205.26 g/mol, XLogP of 1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one is sourced from PubChem (CID 79291259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).