C12H16N2O — CID 79291288
3,3,4,7-tetramethyl-1H-quinoxalin-2-one (PubChem CID 79291288) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3,3,4,7-tetramethyl-1H-quinoxalin-2-one.
| Compound Name | 3,3,4,7-tetramethyl-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 79291288 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3,3,4,7-tetramethyl-1H-quinoxalin-2-one |
| SMILES | Cc1ccc2c(c1)NC(=O)C(C)(C)N2C |
| InChI | InChI=1S/C12H16N2O/c1-8-5-6-10-9(7-8)13-11(15)12(2,3)14(10)4/h5-7H,1-4H3,(H,13,15) |
| InChIKey | MBGFDLFEZGTFSG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |