C8H18N2O4 — CID 79291770
N-(2,3-dihydroxypropyl)-2-(2-methoxyethylamino)acetamide (PubChem CID 79291770) has the molecular formula C8H18N2O4 and a molecular weight of 206.24 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 79291770 |
| Molecular Formula | C8H18N2O4 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2-(2-methoxyethylamino)acetamide |
| SMILES | COCCNCC(=O)NCC(O)CO |
| InChI | InChI=1S/C8H18N2O4/c1-14-3-2-9-5-8(13)10-4-7(12)6-11/h7,9,11-12H,2-6H2,1H3,(H,10,13) |
| InChIKey | AZBBMFJPILRJNZ-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|