C15H21ClN4 — CID 79292874
2-(2-chloroethyl)-1-(1-ethylpiperidin-3-yl)imidazo[4,5-c]pyridine (PubChem CID 79292874) has the molecular formula C15H21ClN4 and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(1-ethylpiperidin-3-yl)imidazo[4,5-c]pyridine.
| Compound Name | 2-(2-chloroethyl)-1-(1-ethylpiperidin-3-yl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 79292874 |
| Molecular Formula | C15H21ClN4 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-(2-chloroethyl)-1-(1-ethylpiperidin-3-yl)imidazo[4,5-c]pyridine |
| SMILES | CCN1CCCC(n2c(CCCl)nc3cnccc32)C1 |
| InChI | InChI=1S/C15H21ClN4/c1-2-19-9-3-4-12(11-19)20-14-6-8-17-10-13(14)18-15(20)5-7-16/h6,8,10,12H,2-5,7,9,11H2,1H3 |
| InChIKey | ISBADSHSENDALI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|