About 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one
8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one (PubChem CID 79293097) has the molecular formula C14H13N3O
and a molecular weight of 239.28 g/mol. Its IUPAC name is 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one |
| PubChem CID | 79293097 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one |
| SMILES | Cc1ccnc2c1NC(=O)C(c1ccccc1)N2 |
| InChI | InChI=1S/C14H13N3O/c1-9-7-8-15-13-11(9)17-14(18)12(16-13)10-5-3-2-4-6-10/h2-8,12H,1H3,(H,15,16)(H,17,18) |
| InChIKey | GLOYXPYILDMLFZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one?
The IUPAC name of 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one (CID 79293097) is 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one.
What is the SMILES notation for 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one?
The canonical SMILES for 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one is Cc1ccnc2c1NC(=O)C(c1ccccc1)N2.
What is the InChIKey of 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one?
The InChIKey is GLOYXPYILDMLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O/c1-9-7-8-15-13-11(9)17-14(18)12(16-13)10-5-3-2-4-6-10/h2-8,12H,1H3,(H,15,16)(H,17,18).
What are the key properties of 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one?
8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one has a molecular weight of 239.28 g/mol, XLogP of 2.50, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-3-phenyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one is sourced from PubChem (CID 79293097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).