C10H13N3O — CID 79293098
4,9-dimethyl-1,3,4,5-tetrahydropyrido[2,3-b][1,4]diazepin-2-one (PubChem CID 79293098) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 4,9-dimethyl-1,3,4,5-tetrahydropyrido[2,3-b][1,4]diazepin-2-one.
| Compound Name | 4,9-dimethyl-1,3,4,5-tetrahydropyrido[2,3-b][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 79293098 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4,9-dimethyl-1,3,4,5-tetrahydropyrido[2,3-b][1,4]diazepin-2-one |
| SMILES | Cc1ccnc2c1NC(=O)CC(C)N2 |
| InChI | InChI=1S/C10H13N3O/c1-6-3-4-11-10-9(6)13-8(14)5-7(2)12-10/h3-4,7H,5H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | RYPFDTRPICWVQN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |