C12H16ClN3 — CID 79293279
3-butan-2-yl-2-(chloromethyl)-7-methylimidazo[4,5-b]pyridine (PubChem CID 79293279) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is 3-butan-2-yl-2-(chloromethyl)-7-methylimidazo[4,5-b]pyridine.
| Compound Name | 3-butan-2-yl-2-(chloromethyl)-7-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79293279 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 3-butan-2-yl-2-(chloromethyl)-7-methylimidazo[4,5-b]pyridine |
| SMILES | CCC(C)n1c(CCl)nc2c(C)ccnc21 |
| InChI | InChI=1S/C12H16ClN3/c1-4-9(3)16-10(7-13)15-11-8(2)5-6-14-12(11)16/h5-6,9H,4,7H2,1-3H3 |
| InChIKey | KBWIVTPMQUBYAP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|