C11H11ClF3N3 — CID 79294318
2-(1-chloroethyl)-3-(3,3,3-trifluoropropyl)imidazo[4,5-b]pyridine (PubChem CID 79294318) has the molecular formula C11H11ClF3N3 and a molecular weight of 277.68 g/mol. Its IUPAC name is 2-(1-chloroethyl)-3-(3,3,3-trifluoropropyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(1-chloroethyl)-3-(3,3,3-trifluoropropyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79294318 |
| Molecular Formula | C11H11ClF3N3 |
| Molecular Weight | 277.68 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-(1-chloroethyl)-3-(3,3,3-trifluoropropyl)imidazo[4,5-b]pyridine |
| SMILES | CC(Cl)c1nc2cccnc2n1CCC(F)(F)F |
| InChI | InChI=1S/C11H11ClF3N3/c1-7(12)9-17-8-3-2-5-16-10(8)18(9)6-4-11(13,14)15/h2-3,5,7H,4,6H2,1H3 |
| InChIKey | ZLUVYHRDYIYETJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.68 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|