C8H9F3N4S — CID 79294413
1,3-dimethyl-6-(2,2,2-trifluoroethyl)-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79294413) has the molecular formula C8H9F3N4S and a molecular weight of 250.25 g/mol. Its IUPAC name is 1,3-dimethyl-6-(2,2,2-trifluoroethyl)-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 1,3-dimethyl-6-(2,2,2-trifluoroethyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79294413 |
| Molecular Formula | C8H9F3N4S |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1,3-dimethyl-6-(2,2,2-trifluoroethyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | Cc1nn(C)c2c1[nH]c(=S)n2CC(F)(F)F |
| InChI | InChI=1S/C8H9F3N4S/c1-4-5-6(14(2)13-4)15(7(16)12-5)3-8(9,10)11/h3H2,1-2H3,(H,12,16) |
| InChIKey | GTCMZYDAOMHDNK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|