C15H13N3O — CID 79294766
1,3,8-triazatetracyclo[8.8.0.02,7.011,16]octadeca-2(7),3,5,11,13,15-hexaen-9-one (PubChem CID 79294766) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is 1,3,8-triazatetracyclo[8.8.0.02,7.011,16]octadeca-2(7),3,5,11,13,15-hexaen-9-one.
| Compound Name | 1,3,8-triazatetracyclo[8.8.0.02,7.011,16]octadeca-2(7),3,5,11,13,15-hexaen-9-one |
|---|---|
| PubChem CID | 79294766 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1,3,8-triazatetracyclo[8.8.0.02,7.011,16]octadeca-2(7),3,5,11,13,15-hexaen-9-one |
| SMILES | O=C1Nc2cccnc2N2CCc3ccccc3C12 |
| InChI | InChI=1S/C15H13N3O/c19-15-13-11-5-2-1-4-10(11)7-9-18(13)14-12(17-15)6-3-8-16-14/h1-6,8,13H,7,9H2,(H,17,19) |
| InChIKey | QPLLJFQFDLFBQO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |