About 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione
1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79294852) has the molecular formula C9H14N4O2S2
and a molecular weight of 274.37 g/mol. Its IUPAC name is 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione.
Molecular Properties
| Compound Name | 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
| PubChem CID | 79294852 |
| Molecular Formula | C9H14N4O2S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | Cc1nn(C)c2c1[nH]c(=S)n2CCS(C)(=O)=O |
| InChI | InChI=1S/C9H14N4O2S2/c1-6-7-8(12(2)11-6)13(9(16)10-7)4-5-17(3,14)15/h4-5H2,1-3H3,(H,10,16) |
| InChIKey | ZGTFXIZOCYTONK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione?
The IUPAC name of 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione (CID 79294852) is 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione.
What is the SMILES notation for 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione?
The canonical SMILES for 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione is Cc1nn(C)c2c1[nH]c(=S)n2CCS(C)(=O)=O.
What is the InChIKey of 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione?
The InChIKey is ZGTFXIZOCYTONK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2S2/c1-6-7-8(12(2)11-6)13(9(16)10-7)4-5-17(3,14)15/h4-5H2,1-3H3,(H,10,16).
What are the key properties of 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione?
1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione has a molecular weight of 274.37 g/mol, XLogP of 0.79, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-6-(2-methylsulfonylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione is sourced from PubChem (CID 79294852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).