About 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine
1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine (PubChem CID 79295340) has the molecular formula C12H8Cl2N4
and a molecular weight of 279.13 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine.
Molecular Properties
| Compound Name | 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine |
| PubChem CID | 79295340 |
| Molecular Formula | C12H8Cl2N4 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine |
| SMILES | Nc1nc2cnccc2n1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H8Cl2N4/c13-7-1-2-8(14)11(5-7)18-10-3-4-16-6-9(10)17-12(18)15/h1-6H,(H2,15,17) |
| InChIKey | FXSMCRXYXUIOTF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine?
The IUPAC name of 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine (CID 79295340) is 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine.
What is the SMILES notation for 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine?
The canonical SMILES for 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine is Nc1nc2cnccc2n1-c1cc(Cl)ccc1Cl.
What is the InChIKey of 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine?
The InChIKey is FXSMCRXYXUIOTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2N4/c13-7-1-2-8(14)11(5-7)18-10-3-4-16-6-9(10)17-12(18)15/h1-6H,(H2,15,17).
What are the key properties of 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine?
1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine has a molecular weight of 279.13 g/mol, XLogP of 3.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dichlorophenyl)imidazo[4,5-c]pyridin-2-amine is sourced from PubChem (CID 79295340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).