About 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one
7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one (PubChem CID 79295412) has the molecular formula C11H11FN2O2
and a molecular weight of 222.22 g/mol. Its IUPAC name is 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one.
Molecular Properties
| Compound Name | 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one |
| PubChem CID | 79295412 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one |
| SMILES | O=C1Nc2cc(F)ccc2NC12CCOC2 |
| InChI | InChI=1S/C11H11FN2O2/c12-7-1-2-8-9(5-7)13-10(15)11(14-8)3-4-16-6-11/h1-2,5,14H,3-4,6H2,(H,13,15) |
| InChIKey | DWBAFEIARAWMLH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one?
The IUPAC name of 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one (CID 79295412) is 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one.
What is the SMILES notation for 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one?
The canonical SMILES for 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one is O=C1Nc2cc(F)ccc2NC12CCOC2.
What is the InChIKey of 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one?
The InChIKey is DWBAFEIARAWMLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O2/c12-7-1-2-8-9(5-7)13-10(15)11(14-8)3-4-16-6-11/h1-2,5,14H,3-4,6H2,(H,13,15).
What are the key properties of 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one?
7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one has a molecular weight of 222.22 g/mol, XLogP of 1.35, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one is sourced from PubChem (CID 79295412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).