About 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine
1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine (PubChem CID 79295428) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine.
Molecular Properties
| Compound Name | 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine |
| PubChem CID | 79295428 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine |
| SMILES | CCOCCCn1c(N)nc2cnccc21 |
| InChI | InChI=1S/C11H16N4O/c1-2-16-7-3-6-15-10-4-5-13-8-9(10)14-11(15)12/h4-5,8H,2-3,6-7H2,1H3,(H2,12,14) |
| InChIKey | MVVNUDWFMKAXLL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine?
The IUPAC name of 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine (CID 79295428) is 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine.
What is the SMILES notation for 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine?
The canonical SMILES for 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine is CCOCCCn1c(N)nc2cnccc21.
What is the InChIKey of 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine?
The InChIKey is MVVNUDWFMKAXLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O/c1-2-16-7-3-6-15-10-4-5-13-8-9(10)14-11(15)12/h4-5,8H,2-3,6-7H2,1H3,(H2,12,14).
What are the key properties of 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine?
1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine has a molecular weight of 220.28 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxypropyl)imidazo[4,5-c]pyridin-2-amine is sourced from PubChem (CID 79295428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).