About 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine
1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine (PubChem CID 79295711) has the molecular formula C11H11N5O
and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine.
Molecular Properties
| Compound Name | 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine |
| PubChem CID | 79295711 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine |
| SMILES | Cc1cc(Cn2c(N)nc3cnccc32)on1 |
| InChI | InChI=1S/C11H11N5O/c1-7-4-8(17-15-7)6-16-10-2-3-13-5-9(10)14-11(16)12/h2-5H,6H2,1H3,(H2,12,14) |
| InChIKey | CXXWQXFOWYFELQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine?
The IUPAC name of 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine (CID 79295711) is 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine.
What is the SMILES notation for 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine?
The canonical SMILES for 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine is Cc1cc(Cn2c(N)nc3cnccc32)on1.
What is the InChIKey of 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine?
The InChIKey is CXXWQXFOWYFELQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5O/c1-7-4-8(17-15-7)6-16-10-2-3-13-5-9(10)14-11(16)12/h2-5H,6H2,1H3,(H2,12,14).
What are the key properties of 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine?
1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine has a molecular weight of 229.24 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-c]pyridin-2-amine is sourced from PubChem (CID 79295711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).