About 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one
2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one (PubChem CID 79295856) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one |
| PubChem CID | 79295856 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one |
| SMILES | CCC1C(=O)Nc2cnccc2N1C |
| InChI | InChI=1S/C10H13N3O/c1-3-8-10(14)12-7-6-11-5-4-9(7)13(8)2/h4-6,8H,3H2,1-2H3,(H,12,14) |
| InChIKey | WRXJKXGLEZAFMB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one?
The IUPAC name of 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one (CID 79295856) is 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one.
What is the SMILES notation for 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one?
The canonical SMILES for 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one is CCC1C(=O)Nc2cnccc2N1C.
What is the InChIKey of 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one?
The InChIKey is WRXJKXGLEZAFMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-3-8-10(14)12-7-6-11-5-4-9(7)13(8)2/h4-6,8H,3H2,1-2H3,(H,12,14).
What are the key properties of 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one?
2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one has a molecular weight of 191.23 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-methyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one is sourced from PubChem (CID 79295856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).