About 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine
1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine (PubChem CID 79295875) has the molecular formula C13H21N5
and a molecular weight of 247.35 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine.
Molecular Properties
| Compound Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine |
| PubChem CID | 79295875 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine |
| SMILES | CN(C)CC(C)(C)Cn1c(N)nc2cnccc21 |
| InChI | InChI=1S/C13H21N5/c1-13(2,8-17(3)4)9-18-11-5-6-15-7-10(11)16-12(18)14/h5-7H,8-9H2,1-4H3,(H2,14,16) |
| InChIKey | OGPASCFOUXCORU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine?
The IUPAC name of 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine (CID 79295875) is 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine.
What is the SMILES notation for 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine?
The canonical SMILES for 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine is CN(C)CC(C)(C)Cn1c(N)nc2cnccc21.
What is the InChIKey of 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine?
The InChIKey is OGPASCFOUXCORU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5/c1-13(2,8-17(3)4)9-18-11-5-6-15-7-10(11)16-12(18)14/h5-7H,8-9H2,1-4H3,(H2,14,16).
What are the key properties of 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine?
1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine has a molecular weight of 247.35 g/mol, XLogP of 1.60, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(dimethylamino)-2,2-dimethylpropyl]imidazo[4,5-c]pyridin-2-amine is sourced from PubChem (CID 79295875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).