C12H12ClFN2OS — CID 79296045
9-chloro-10-fluoro-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one (PubChem CID 79296045) has the molecular formula C12H12ClFN2OS and a molecular weight of 286.76 g/mol. Its IUPAC name is 9-chloro-10-fluoro-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one.
| Compound Name | 9-chloro-10-fluoro-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one |
|---|---|
| PubChem CID | 79296045 |
| Molecular Formula | C12H12ClFN2OS |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 9-chloro-10-fluoro-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one |
| SMILES | O=C1CC2CSCCN2c2cc(F)c(Cl)cc2N1 |
| InChI | InChI=1S/C12H12ClFN2OS/c13-8-4-10-11(5-9(8)14)16-1-2-18-6-7(16)3-12(17)15-10/h4-5,7H,1-3,6H2,(H,15,17) |
| InChIKey | DSJBYWNIPOUBPO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |