About 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one
4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one (PubChem CID 79296211) has the molecular formula C10H11FN2O
and a molecular weight of 194.21 g/mol. Its IUPAC name is 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one.
Molecular Properties
| Compound Name | 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one |
| PubChem CID | 79296211 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one |
| SMILES | CCN1CC(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C10H11FN2O/c1-2-13-6-10(14)12-8-4-3-7(11)5-9(8)13/h3-5H,2,6H2,1H3,(H,12,14) |
| InChIKey | JRQIINAHIHRTLJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one?
The IUPAC name of 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one (CID 79296211) is 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one.
What is the SMILES notation for 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one?
The canonical SMILES for 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one is CCN1CC(=O)Nc2ccc(F)cc21.
What is the InChIKey of 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one?
The InChIKey is JRQIINAHIHRTLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O/c1-2-13-6-10(14)12-8-4-3-7(11)5-9(8)13/h3-5H,2,6H2,1H3,(H,12,14).
What are the key properties of 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one?
4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one has a molecular weight of 194.21 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6-fluoro-1,3-dihydroquinoxalin-2-one is sourced from PubChem (CID 79296211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).