About 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine
1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine (PubChem CID 79296444) has the molecular formula C11H14N4O2S
and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine.
Molecular Properties
| Compound Name | 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine |
| PubChem CID | 79296444 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine |
| SMILES | Nc1nc2cnccc2n1C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H14N4O2S/c12-11-14-9-6-13-4-3-10(9)15(11)8-2-1-5-18(16,17)7-8/h3-4,6,8H,1-2,5,7H2,(H2,12,14) |
| InChIKey | OVOQHSUCHGQARZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine?
The IUPAC name of 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine (CID 79296444) is 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine.
What is the SMILES notation for 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine?
The canonical SMILES for 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine is Nc1nc2cnccc2n1C1CCCS(=O)(=O)C1.
What is the InChIKey of 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine?
The InChIKey is OVOQHSUCHGQARZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2S/c12-11-14-9-6-13-4-3-10(9)15(11)8-2-1-5-18(16,17)7-8/h3-4,6,8H,1-2,5,7H2,(H2,12,14).
What are the key properties of 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine?
1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine has a molecular weight of 266.33 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothian-3-yl)imidazo[4,5-c]pyridin-2-amine is sourced from PubChem (CID 79296444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).