C9H10ClF3N4 — CID 79297088
5-(chloromethyl)-1,3-dimethyl-6-(2,2,2-trifluoroethyl)imidazo[4,5-d]pyrazole (PubChem CID 79297088) has the molecular formula C9H10ClF3N4 and a molecular weight of 266.65 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-dimethyl-6-(2,2,2-trifluoroethyl)imidazo[4,5-d]pyrazole.
| Compound Name | 5-(chloromethyl)-1,3-dimethyl-6-(2,2,2-trifluoroethyl)imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79297088 |
| Molecular Formula | C9H10ClF3N4 |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 5-(chloromethyl)-1,3-dimethyl-6-(2,2,2-trifluoroethyl)imidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(C)c2c1nc(CCl)n2CC(F)(F)F |
| InChI | InChI=1S/C9H10ClF3N4/c1-5-7-8(16(2)15-5)17(4-9(11,12)13)6(3-10)14-7/h3-4H2,1-2H3 |
| InChIKey | UFDDHTFIKRNNEB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|