C10H12ClF3N4 — CID 79297162
5-(1-chloroethyl)-1,3-dimethyl-6-(2,2,2-trifluoroethyl)imidazo[4,5-d]pyrazole (PubChem CID 79297162) has the molecular formula C10H12ClF3N4 and a molecular weight of 280.68 g/mol. Its IUPAC name is 5-(1-chloroethyl)-1,3-dimethyl-6-(2,2,2-trifluoroethyl)imidazo[4,5-d]pyrazole.
| Compound Name | 5-(1-chloroethyl)-1,3-dimethyl-6-(2,2,2-trifluoroethyl)imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79297162 |
| Molecular Formula | C10H12ClF3N4 |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 5-(1-chloroethyl)-1,3-dimethyl-6-(2,2,2-trifluoroethyl)imidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(C)c2c1nc(C(C)Cl)n2CC(F)(F)F |
| InChI | InChI=1S/C10H12ClF3N4/c1-5(11)8-15-7-6(2)16-17(3)9(7)18(8)4-10(12,13)14/h5H,4H2,1-3H3 |
| InChIKey | VYLWBUNYOXQGRH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|