C14H18N4OS — CID 79297189
6-[1-(2,5-dimethylfuran-3-yl)ethyl]-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79297189) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 6-[1-(2,5-dimethylfuran-3-yl)ethyl]-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 6-[1-(2,5-dimethylfuran-3-yl)ethyl]-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79297189 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 6-[1-(2,5-dimethylfuran-3-yl)ethyl]-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | Cc1cc(C(C)n2c(=S)[nH]c3c(C)nn(C)c32)c(C)o1 |
| InChI | InChI=1S/C14H18N4OS/c1-7-6-11(10(4)19-7)9(3)18-13-12(15-14(18)20)8(2)16-17(13)5/h6,9H,1-5H3,(H,15,20) |
| InChIKey | HQHMWJBTJYZZFE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 51.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|