C13H20ClN5O — CID 79297254
2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-N,N-dimethylpropanamide (PubChem CID 79297254) has the molecular formula C13H20ClN5O and a molecular weight of 297.79 g/mol. Its IUPAC name is 2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-N,N-dimethylpropanamide.
| Compound Name | 2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 79297254 |
| Molecular Formula | C13H20ClN5O |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-N,N-dimethylpropanamide |
| SMILES | Cc1nn(C)c2c1nc(C(C)Cl)n2C(C)C(=O)N(C)C |
| InChI | InChI=1S/C13H20ClN5O/c1-7(14)11-15-10-8(2)16-18(6)12(10)19(11)9(3)13(20)17(4)5/h7,9H,1-6H3 |
| InChIKey | QLXYSSFJOZDBQB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|