About 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide
4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide (PubChem CID 79297320) has the molecular formula C12H18ClN5O
and a molecular weight of 283.76 g/mol. Its IUPAC name is 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide.
Molecular Properties
| Compound Name | 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide |
| PubChem CID | 79297320 |
| Molecular Formula | C12H18ClN5O |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide |
| SMILES | Cc1nn(C)c2c1nc(C(C)Cl)n2CCCC(N)=O |
| InChI | InChI=1S/C12H18ClN5O/c1-7(13)11-15-10-8(2)16-17(3)12(10)18(11)6-4-5-9(14)19/h7H,4-6H2,1-3H3,(H2,14,19) |
| InChIKey | POHKKYZWRMVWSW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide?
The IUPAC name of 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide (CID 79297320) is 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide.
What is the SMILES notation for 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide?
The canonical SMILES for 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide is Cc1nn(C)c2c1nc(C(C)Cl)n2CCCC(N)=O.
What is the InChIKey of 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide?
The InChIKey is POHKKYZWRMVWSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN5O/c1-7(13)11-15-10-8(2)16-17(3)12(10)18(11)6-4-5-9(14)19/h7H,4-6H2,1-3H3,(H2,14,19).
What are the key properties of 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide?
4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide has a molecular weight of 283.76 g/mol, XLogP of 1.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]butanamide is sourced from PubChem (CID 79297320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).