C12H10Cl2N4S — CID 79297411
6-(2,6-dichlorophenyl)-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79297411) has the molecular formula C12H10Cl2N4S and a molecular weight of 313.21 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 6-(2,6-dichlorophenyl)-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79297411 |
| Molecular Formula | C12H10Cl2N4S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | Cc1nn(C)c2c1[nH]c(=S)n2-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H10Cl2N4S/c1-6-9-11(17(2)16-6)18(12(19)15-9)10-7(13)4-3-5-8(10)14/h3-5H,1-2H3,(H,15,19) |
| InChIKey | PWQGFMQKZBZJEG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|