About 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile
3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile (PubChem CID 79297433) has the molecular formula C14H14N6
and a molecular weight of 266.31 g/mol. Its IUPAC name is 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile |
| PubChem CID | 79297433 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile |
| SMILES | Cc1nn(C)c2c1nc(N)n2Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C14H14N6/c1-9-12-13(19(2)18-9)20(14(16)17-12)8-11-5-3-4-10(6-11)7-15/h3-6H,8H2,1-2H3,(H2,16,17) |
| InChIKey | YZWUVJLYTIZUIP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile?
The IUPAC name of 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile (CID 79297433) is 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile.
What is the SMILES notation for 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile?
The canonical SMILES for 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile is Cc1nn(C)c2c1nc(N)n2Cc1cccc(C#N)c1.
What is the InChIKey of 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile?
The InChIKey is YZWUVJLYTIZUIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N6/c1-9-12-13(19(2)18-9)20(14(16)17-12)8-11-5-3-4-10(6-11)7-15/h3-6H,8H2,1-2H3,(H2,16,17).
What are the key properties of 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile?
3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile has a molecular weight of 266.31 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)methyl]benzonitrile is sourced from PubChem (CID 79297433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).