C13H11ClF2N4 — CID 79297663
5-(chloromethyl)-6-(3,5-difluorophenyl)-1,3-dimethylimidazo[4,5-d]pyrazole (PubChem CID 79297663) has the molecular formula C13H11ClF2N4 and a molecular weight of 296.71 g/mol. Its IUPAC name is 5-(chloromethyl)-6-(3,5-difluorophenyl)-1,3-dimethylimidazo[4,5-d]pyrazole.
| Compound Name | 5-(chloromethyl)-6-(3,5-difluorophenyl)-1,3-dimethylimidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79297663 |
| Molecular Formula | C13H11ClF2N4 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 5-(chloromethyl)-6-(3,5-difluorophenyl)-1,3-dimethylimidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(C)c2c1nc(CCl)n2-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H11ClF2N4/c1-7-12-13(19(2)18-7)20(11(6-14)17-12)10-4-8(15)3-9(16)5-10/h3-5H,6H2,1-2H3 |
| InChIKey | FFPZCGNXNJXCOI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|