C14H22N4S — CID 79297829
6-(4,4-dimethylcyclohexyl)-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79297829) has the molecular formula C14H22N4S and a molecular weight of 278.42 g/mol. Its IUPAC name is 6-(4,4-dimethylcyclohexyl)-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 6-(4,4-dimethylcyclohexyl)-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79297829 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 6-(4,4-dimethylcyclohexyl)-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | Cc1nn(C)c2c1[nH]c(=S)n2C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H22N4S/c1-9-11-12(17(4)16-9)18(13(19)15-11)10-5-7-14(2,3)8-6-10/h10H,5-8H2,1-4H3,(H,15,19) |
| InChIKey | FBMKMPWNAPJJKP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|