C14H24O3 — CID 79298264
ethyl 2,4-diethyl-1-oxaspiro[2.5]octane-2-carboxylate (PubChem CID 79298264) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is ethyl 2,4-diethyl-1-oxaspiro[2.5]octane-2-carboxylate.
| Compound Name | ethyl 2,4-diethyl-1-oxaspiro[2.5]octane-2-carboxylate |
|---|---|
| PubChem CID | 79298264 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | ethyl 2,4-diethyl-1-oxaspiro[2.5]octane-2-carboxylate |
| SMILES | CCOC(=O)C1(CC)OC12CCCCC2CC |
| InChI | InChI=1S/C14H24O3/c1-4-11-9-7-8-10-14(11)13(5-2,17-14)12(15)16-6-3/h11H,4-10H2,1-3H3 |
| InChIKey | WYKDMUZEOUIUKY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|