About 3-bromo-1-methoxy-2,4-dimethylpentane
3-bromo-1-methoxy-2,4-dimethylpentane (PubChem CID 79298776) has the molecular formula C8H17BrO
and a molecular weight of 209.13 g/mol. Its IUPAC name is 3-bromo-1-methoxy-2,4-dimethylpentane.
Molecular Properties
| Compound Name | 3-bromo-1-methoxy-2,4-dimethylpentane |
| PubChem CID | 79298776 |
| Molecular Formula | C8H17BrO |
| Molecular Weight | 209.13 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3-bromo-1-methoxy-2,4-dimethylpentane |
| SMILES | COCC(C)C(Br)C(C)C |
| InChI | InChI=1S/C8H17BrO/c1-6(2)8(9)7(3)5-10-4/h6-8H,5H2,1-4H3 |
| InChIKey | SCWWIDOPIODTRX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.13 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-methoxy-2,4-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-methoxy-2,4-dimethylpentane?
The IUPAC name of 3-bromo-1-methoxy-2,4-dimethylpentane (CID 79298776) is 3-bromo-1-methoxy-2,4-dimethylpentane.
What is the SMILES notation for 3-bromo-1-methoxy-2,4-dimethylpentane?
The canonical SMILES for 3-bromo-1-methoxy-2,4-dimethylpentane is COCC(C)C(Br)C(C)C.
What is the InChIKey of 3-bromo-1-methoxy-2,4-dimethylpentane?
The InChIKey is SCWWIDOPIODTRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17BrO/c1-6(2)8(9)7(3)5-10-4/h6-8H,5H2,1-4H3.
What are the key properties of 3-bromo-1-methoxy-2,4-dimethylpentane?
3-bromo-1-methoxy-2,4-dimethylpentane has a molecular weight of 209.13 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-methoxy-2,4-dimethylpentane is sourced from PubChem (CID 79298776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).