C11H15F3N4OS — CID 79299762
3-ethyl-1-methyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79299762) has the molecular formula C11H15F3N4OS and a molecular weight of 308.33 g/mol. Its IUPAC name is 3-ethyl-1-methyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 3-ethyl-1-methyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79299762 |
| Molecular Formula | C11H15F3N4OS |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3-ethyl-1-methyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCc1nn(C)c2c1[nH]c(=S)n2CCOCC(F)(F)F |
| InChI | InChI=1S/C11H15F3N4OS/c1-3-7-8-9(17(2)16-7)18(10(20)15-8)4-5-19-6-11(12,13)14/h3-6H2,1-2H3,(H,15,20) |
| InChIKey | ISXZYINAYBXHQH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|