C14H20N4S — CID 79299830
6-(2-bicyclo[2.2.1]heptanyl)-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79299830) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is 6-(2-bicyclo[2.2.1]heptanyl)-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 6-(2-bicyclo[2.2.1]heptanyl)-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79299830 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 6-(2-bicyclo[2.2.1]heptanyl)-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCc1nn(C)c2c1[nH]c(=S)n2C1CC2CCC1C2 |
| InChI | InChI=1S/C14H20N4S/c1-3-10-12-13(17(2)16-10)18(14(19)15-12)11-7-8-4-5-9(11)6-8/h8-9,11H,3-7H2,1-2H3,(H,15,19) |
| InChIKey | PUOWSXMKLJLRNQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|