C11H16F3N5O — CID 79299851
3-ethyl-1-methyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]imidazo[4,5-d]pyrazol-5-amine (PubChem CID 79299851) has the molecular formula C11H16F3N5O and a molecular weight of 291.28 g/mol. Its IUPAC name is 3-ethyl-1-methyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]imidazo[4,5-d]pyrazol-5-amine.
| Compound Name | 3-ethyl-1-methyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]imidazo[4,5-d]pyrazol-5-amine |
|---|---|
| PubChem CID | 79299851 |
| Molecular Formula | C11H16F3N5O |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 3-ethyl-1-methyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]imidazo[4,5-d]pyrazol-5-amine |
| SMILES | CCc1nn(C)c2c1nc(N)n2CCOCC(F)(F)F |
| InChI | InChI=1S/C11H16F3N5O/c1-3-7-8-9(18(2)17-7)19(10(15)16-8)4-5-20-6-11(12,13)14/h3-6H2,1-2H3,(H2,15,16) |
| InChIKey | ALFAUZFIVMEXNU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|